C32H34FN5O4S — CID 57406999
[4-[[4-[1-(4-fluorophenyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]sulfamic acid (PubChem CID 57406999) has the molecular formula C32H34FN5O4S and a molecular weight of 603.72 g/mol. Its IUPAC name is [4-[[4-[1-(4-fluorophenyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[4-[1-(4-fluorophenyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 57406999 |
| Molecular Formula | C32H34FN5O4S |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | [4-[[4-[1-(4-fluorophenyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]sulfamic acid |
| SMILES | O=C(c1cnn(-c2ccc(F)cc2)c1C1CCN(Cc2ccc(NS(=O)(=O)O)cc2)CC1)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C32H34FN5O4S/c33-27-8-12-29(13-9-27)38-31(30(20-34-38)32(39)37-19-16-26(22-37)24-4-2-1-3-5-24)25-14-17-36(18-15-25)21-23-6-10-28(11-7-23)35-43(40,41)42/h1-13,20,25-26,35H,14-19,21-22H2,(H,40,41,42)/t26-/m0/s1 |
| InChIKey | QFOHPPSEGGQALB-SANMLTNESA-N |
| XLogP | 5.24 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|