C19H27NO3Si — CID 57407422
(8S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 57407422) has the molecular formula C19H27NO3Si and a molecular weight of 345.52 g/mol. Its IUPAC name is (8S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | (8S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 57407422 |
| Molecular Formula | C19H27NO3Si |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (8S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C2=C(O)C(=O)N3CCC[C@@H]23)cc1 |
| InChI | InChI=1S/C19H27NO3Si/c1-19(2,3)24(4,5)23-14-10-8-13(9-11-14)16-15-7-6-12-20(15)18(22)17(16)21/h8-11,15,21H,6-7,12H2,1-5H3/t15-/m0/s1 |
| InChIKey | LZLZYSZPOQESIT-HNNXBMFYSA-N |
| XLogP | 4.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|