C9H10O6 — CID 57407593
dimethyl (1R,5R)-3-oxo-2-oxabicyclo[3.1.0]hexane-6,6-dicarboxylate (PubChem CID 57407593) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is dimethyl (1R,5R)-3-oxo-2-oxabicyclo[3.1.0]hexane-6,6-dicarboxylate.
| Compound Name | dimethyl (1R,5R)-3-oxo-2-oxabicyclo[3.1.0]hexane-6,6-dicarboxylate |
|---|---|
| PubChem CID | 57407593 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | dimethyl (1R,5R)-3-oxo-2-oxabicyclo[3.1.0]hexane-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C9H10O6/c1-13-7(11)9(8(12)14-2)4-3-5(10)15-6(4)9/h4,6H,3H2,1-2H3/t4-,6+/m0/s1 |
| InChIKey | LCUHEZXKCPZGHK-UJURSFKZSA-N |
| XLogP | -0.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|