C7H6N2O5S2 — CID 57407714
1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide (PubChem CID 57407714) has the molecular formula C7H6N2O5S2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide.
| Compound Name | 1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 57407714 |
| Molecular Formula | C7H6N2O5S2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)S(=O)(=O)NC2=O |
| InChI | InChI=1S/C7H6N2O5S2/c8-15(11,12)4-1-2-5-6(3-4)16(13,14)9-7(5)10/h1-3H,(H,9,10)(H2,8,11,12) |
| InChIKey | CRSHTYPFKXPVRE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |