C31H43N3O7 — CID 57407922
(2S,4R)-1-[(2S)-2-(2,2-dimethylpent-4-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-(4-prop-2-enyl-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-2-carboxylic acid (PubChem CID 57407922) has the molecular formula C31H43N3O7 and a molecular weight of 569.70 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-(2,2-dimethylpent-4-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-(4-prop-2-enyl-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-[(2S)-2-(2,2-dimethylpent-4-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-(4-prop-2-enyl-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 57407922 |
| Molecular Formula | C31H43N3O7 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-(2,2-dimethylpent-4-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-(4-prop-2-enyl-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-2-carboxylic acid |
| SMILES | C=CCc1cccc2c1CN(C(=O)O[C@@H]1C[C@@H](C(=O)O)N(C(=O)[C@@H](NC(=O)OCC(C)(C)CC=C)C(C)(C)C)C1)C2 |
| InChI | InChI=1S/C31H43N3O7/c1-8-11-20-12-10-13-21-16-33(18-23(20)21)29(39)41-22-15-24(27(36)37)34(17-22)26(35)25(30(3,4)5)32-28(38)40-19-31(6,7)14-9-2/h8-10,12-13,22,24-25H,1-2,11,14-19H2,3-7H3,(H,32,38)(H,36,37)/t22-,24+,25-/m1/s1 |
| InChIKey | JVZOIBPRFRUCPQ-PZUNEJSGSA-N |
| XLogP | 4.66 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|