C25H17N3O4 — CID 57408215
methyl 2-(1-cyanoethenyl)-6,8-dioxa-13,23-diazahexacyclo[11.10.1.03,11.05,9.014,19.020,24]tetracosa-1(24),3,5(9),10,14,16,18,20,22-nonaene-22-carboxylate (PubChem CID 57408215) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is methyl 2-(1-cyanoethenyl)-6,8-dioxa-13,23-diazahexacyclo[11.10.1.03,11.05,9.014,19.020,24]tetracosa-1(24),3,5(9),10,14,16,18,20,22-nonaene-22-carboxylate.
| Compound Name | methyl 2-(1-cyanoethenyl)-6,8-dioxa-13,23-diazahexacyclo[11.10.1.03,11.05,9.014,19.020,24]tetracosa-1(24),3,5(9),10,14,16,18,20,22-nonaene-22-carboxylate |
|---|---|
| PubChem CID | 57408215 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | methyl 2-(1-cyanoethenyl)-6,8-dioxa-13,23-diazahexacyclo[11.10.1.03,11.05,9.014,19.020,24]tetracosa-1(24),3,5(9),10,14,16,18,20,22-nonaene-22-carboxylate |
| SMILES | C=C(C#N)C1c2cc3c(cc2Cn2c4ccccc4c4cc(C(=O)OC)nc1c42)OCO3 |
| InChI | InChI=1S/C25H17N3O4/c1-13(10-26)22-16-9-21-20(31-12-32-21)7-14(16)11-28-19-6-4-3-5-15(19)17-8-18(25(29)30-2)27-23(22)24(17)28/h3-9,22H,1,11-12H2,2H3 |
| InChIKey | KEZXTKSCMNUEFO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|