C14H22O2 — CID 57408411
(1R,3R,4R,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-methylcyclohexane-1,3-diol (PubChem CID 57408411) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,3R,4R,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-methylcyclohexane-1,3-diol.
| Compound Name | (1R,3R,4R,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-methylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 57408411 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,3R,4R,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-methylcyclohexane-1,3-diol |
| SMILES | C/C=C/C=C/C=C/[C@H]1C[C@@H](O)C[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C14H22O2/c1-3-4-5-6-7-8-12-9-13(15)10-14(16)11(12)2/h3-8,11-16H,9-10H2,1-2H3/b4-3+,6-5+,8-7+/t11-,12+,13-,14-/m1/s1 |
| InChIKey | AOFKGHCPEZTWMZ-KXIQJYATSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|