C12H10Br3NO5 — CID 57408716
5-oxo-1-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 57408716) has the molecular formula C12H10Br3NO5 and a molecular weight of 487.93 g/mol. Its IUPAC name is 5-oxo-1-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 5-oxo-1-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 57408716 |
| Molecular Formula | C12H10Br3NO5 |
| Molecular Weight | 487.93 g/mol |
| Exact Mass | 484.81 |
| IUPAC Name | 5-oxo-1-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(=O)N1Cc1c(Br)c(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C12H10Br3NO5/c13-7-4(8(14)10(18)11(19)9(7)15)3-16-5(12(20)21)1-2-6(16)17/h5,18-19H,1-3H2,(H,20,21) |
| InChIKey | LIIDTINFOSWOIX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|