C24H17F3N2O6 — CID 57408761
methyl (3aS,4R,6aS)-1'-methyl-1,2',3-trioxo-2-phenyl-5'-(trifluoromethoxy)spiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate (PubChem CID 57408761) has the molecular formula C24H17F3N2O6 and a molecular weight of 486.40 g/mol. Its IUPAC name is methyl (3aS,4R,6aS)-1'-methyl-1,2',3-trioxo-2-phenyl-5'-(trifluoromethoxy)spiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate.
| Compound Name | methyl (3aS,4R,6aS)-1'-methyl-1,2',3-trioxo-2-phenyl-5'-(trifluoromethoxy)spiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate |
|---|---|
| PubChem CID | 57408761 |
| Molecular Formula | C24H17F3N2O6 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | methyl (3aS,4R,6aS)-1'-methyl-1,2',3-trioxo-2-phenyl-5'-(trifluoromethoxy)spiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2[C@]12C(=O)N(C)c1ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C24H17F3N2O6/c1-28-17-9-8-13(35-24(25,26)27)10-15(17)23(22(28)33)16(21(32)34-2)11-14-18(23)20(31)29(19(14)30)12-6-4-3-5-7-12/h3-11,14,18H,1-2H3/t14-,18+,23+/m0/s1 |
| InChIKey | XOTQQIRALZATGH-FPULEUEGSA-N |
| XLogP | 2.72 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|