C30H46O4 — CID 57408764
(1S,3R,8R,11R,12R,15R,16R)-15-[(2R,5S)-5-hydroxy-6-methylhept-6-en-2-yl]-7,7,16-trimethyl-6-oxopentacyclo[9.7.0.01,3.03,8.012,16]octadecane-12-carboxylic acid (PubChem CID 57408764) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (1S,3R,8R,11R,12R,15R,16R)-15-[(2R,5S)-5-hydroxy-6-methylhept-6-en-2-yl]-7,7,16-trimethyl-6-oxopentacyclo[9.7.0.01,3.03,8.012,16]octadecane-12-carboxylic acid.
| Compound Name | (1S,3R,8R,11R,12R,15R,16R)-15-[(2R,5S)-5-hydroxy-6-methylhept-6-en-2-yl]-7,7,16-trimethyl-6-oxopentacyclo[9.7.0.01,3.03,8.012,16]octadecane-12-carboxylic acid |
|---|---|
| PubChem CID | 57408764 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (1S,3R,8R,11R,12R,15R,16R)-15-[(2R,5S)-5-hydroxy-6-methylhept-6-en-2-yl]-7,7,16-trimethyl-6-oxopentacyclo[9.7.0.01,3.03,8.012,16]octadecane-12-carboxylic acid |
| SMILES | C=C(C)[C@@H](O)CC[C@@H](C)[C@H]1CC[C@@]2(C(=O)O)[C@@H]3CC[C@H]4C(C)(C)C(=O)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C30H46O4/c1-18(2)21(31)8-7-19(3)20-11-14-30(25(33)34)23-10-9-22-26(4,5)24(32)12-13-28(22)17-29(23,28)16-15-27(20,30)6/h19-23,31H,1,7-17H2,2-6H3,(H,33,34)/t19-,20-,21+,22+,23-,27-,28-,29+,30+/m1/s1 |
| InChIKey | SYVTXPULSBCSAB-CMWTXFCNSA-N |
| XLogP | 6.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|