About CID 57409168
CID 57409168 (PubChem CID 57409168) has the molecular formula C22H27NO4
and a molecular weight of 369.46 g/mol.
Molecular Properties
| Compound Name | CID 57409168 |
| PubChem CID | 57409168 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | — |
| SMILES | CC1=Nc2ccccc2C2(O1)OC1(CCCCC1)C1(CCCCC1)OC2=O |
| InChI | InChI=1S/C22H27NO4/c1-16-23-18-11-5-4-10-17(18)22(25-16)19(24)26-20(12-6-2-7-13-20)21(27-22)14-8-3-9-15-21/h4-5,10-11H,2-3,6-9,12-15H2,1H3 |
| InChIKey | TUFLMTCECRIFFL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 57409168 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57409168?
The IUPAC name of CID 57409168 (CID 57409168) is not available.
What is the SMILES notation for CID 57409168?
The canonical SMILES for CID 57409168 is CC1=Nc2ccccc2C2(O1)OC1(CCCCC1)C1(CCCCC1)OC2=O.
What is the InChIKey of CID 57409168?
The InChIKey is TUFLMTCECRIFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO4/c1-16-23-18-11-5-4-10-17(18)22(25-16)19(24)26-20(12-6-2-7-13-20)21(27-22)14-8-3-9-15-21/h4-5,10-11H,2-3,6-9,12-15H2,1H3.
What are the key properties of CID 57409168?
CID 57409168 has a molecular weight of 369.46 g/mol, XLogP of 4.90, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57409168 is sourced from PubChem (CID 57409168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).