About CID 57409280
CID 57409280 (PubChem CID 57409280) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol.
Molecular Properties
| Compound Name | CID 57409280 |
| PubChem CID | 57409280 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | — |
| SMILES | CN1C(=O)c2ccccc2C2(OC3(CCC3)C23CC3)C1=O |
| InChI | InChI=1S/C17H17NO3/c1-18-13(19)11-5-2-3-6-12(11)17(14(18)20)15(9-10-15)16(21-17)7-4-8-16/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | QFIJOMZBZNBBRP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 57409280 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57409280?
The IUPAC name of CID 57409280 (CID 57409280) is not available.
What is the SMILES notation for CID 57409280?
The canonical SMILES for CID 57409280 is CN1C(=O)c2ccccc2C2(OC3(CCC3)C23CC3)C1=O.
What is the InChIKey of CID 57409280?
The InChIKey is QFIJOMZBZNBBRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-18-13(19)11-5-2-3-6-12(11)17(14(18)20)15(9-10-15)16(21-17)7-4-8-16/h2-3,5-6H,4,7-10H2,1H3.
What are the key properties of CID 57409280?
CID 57409280 has a molecular weight of 283.33 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57409280 is sourced from PubChem (CID 57409280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).