About 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one
5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one (PubChem CID 57409692) has the molecular formula C23H22N2O3
and a molecular weight of 374.44 g/mol. Its IUPAC name is 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one.
Molecular Properties
| Compound Name | 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one |
| PubChem CID | 57409692 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one |
| SMILES | COc1c(Nc2cccc3ccccc23)cc(OC)c2c1c(C)cc(=O)n2C |
| InChI | InChI=1S/C23H22N2O3/c1-14-12-20(26)25(2)22-19(27-3)13-18(23(28-4)21(14)22)24-17-11-7-9-15-8-5-6-10-16(15)17/h5-13,24H,1-4H3 |
| InChIKey | GVWZLACBWREPJT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one?
The IUPAC name of 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one (CID 57409692) is 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one.
What is the SMILES notation for 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one?
The canonical SMILES for 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one is COc1c(Nc2cccc3ccccc23)cc(OC)c2c1c(C)cc(=O)n2C.
What is the InChIKey of 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one?
The InChIKey is GVWZLACBWREPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O3/c1-14-12-20(26)25(2)22-19(27-3)13-18(23(28-4)21(14)22)24-17-11-7-9-15-8-5-6-10-16(15)17/h5-13,24H,1-4H3.
What are the key properties of 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one?
5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one has a molecular weight of 374.44 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethoxy-1,4-dimethyl-6-(naphthalen-1-ylamino)quinolin-2-one is sourced from PubChem (CID 57409692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).