About N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine
N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine (PubChem CID 57410012) has the molecular formula C22H29FN2O
and a molecular weight of 356.49 g/mol. Its IUPAC name is N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine |
| PubChem CID | 57410012 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine |
| SMILES | CC1(C)CC(N(CCNCc2ccccc2)c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C22H29FN2O/c1-22(2)16-21(12-15-26-22)25(20-10-8-19(23)9-11-20)14-13-24-17-18-6-4-3-5-7-18/h3-11,21,24H,12-17H2,1-2H3 |
| InChIKey | NPAJYRWDXPOZGZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine?
The IUPAC name of N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine (CID 57410012) is N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine.
What is the SMILES notation for N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine?
The canonical SMILES for N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine is CC1(C)CC(N(CCNCc2ccccc2)c2ccc(F)cc2)CCO1.
What is the InChIKey of N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine?
The InChIKey is NPAJYRWDXPOZGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29FN2O/c1-22(2)16-21(12-15-26-22)25(20-10-8-19(23)9-11-20)14-13-24-17-18-6-4-3-5-7-18/h3-11,21,24H,12-17H2,1-2H3.
What are the key properties of N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine?
N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine has a molecular weight of 356.49 g/mol, XLogP of 4.38, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-(2,2-dimethyloxan-4-yl)-N'-(4-fluorophenyl)ethane-1,2-diamine is sourced from PubChem (CID 57410012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).