C30H29F3N4O5 — CID 57410458
1-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 57410458) has the molecular formula C30H29F3N4O5 and a molecular weight of 582.58 g/mol. Its IUPAC name is 1-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 1-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 57410458 |
| Molecular Formula | C30H29F3N4O5 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 1-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CC(C)c1ccc(C(=O)C2C(=O)C(=O)N(c3ccc(CN4CCOCC4)nn3)C2c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H29F3N4O5/c1-18(2)19-3-5-21(6-4-19)27(38)25-26(20-7-10-23(11-8-20)42-30(31,32)33)37(29(40)28(25)39)24-12-9-22(34-35-24)17-36-13-15-41-16-14-36/h3-12,18,25-26H,13-17H2,1-2H3 |
| InChIKey | UXNCARKTDSSZBE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|