C30H34N2O6 — CID 57410495
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylimidazole-4-carboxylate (PubChem CID 57410495) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylimidazole-4-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 57410495 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylimidazole-4-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1cncn1-c1ccccc1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H34N2O6/c1-16-12-29-17(2)10-21-23(28(21,3)4)20(25(29)35)11-18(14-33)24(34)30(29,37)26(16)38-27(36)22-13-31-15-32(22)19-8-6-5-7-9-19/h5-9,11-13,15,17,20-21,23-24,26,33-34,37H,10,14H2,1-4H3/t17-,20+,21-,23+,24-,26+,29+,30+/m1/s1 |
| InChIKey | ZSIDCJVEUTVDSJ-CREBYQTMSA-N |
| XLogP | 2.87 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|