C25H35NO7 — CID 57410498
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] morpholine-4-carboxylate (PubChem CID 57410498) has the molecular formula C25H35NO7 and a molecular weight of 461.56 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] morpholine-4-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 57410498 |
| Molecular Formula | C25H35NO7 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] morpholine-4-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)N1CCOCC1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C25H35NO7/c1-13-11-24-14(2)9-17-18(23(17,3)4)16(20(24)29)10-15(12-27)19(28)25(24,31)21(13)33-22(30)26-5-7-32-8-6-26/h10-11,14,16-19,21,27-28,31H,5-9,12H2,1-4H3/t14-,16+,17-,18+,19-,21+,24+,25+/m1/s1 |
| InChIKey | AWMRZSMRZGSDIU-IYACTCEOSA-N |
| XLogP | 1.29 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|