C28H25F3N4O3S — CID 57410566
N-[4-[(2S)-2-methyl-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 57410566) has the molecular formula C28H25F3N4O3S and a molecular weight of 554.59 g/mol. Its IUPAC name is N-[4-[(2S)-2-methyl-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[(2S)-2-methyl-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 57410566 |
| Molecular Formula | C28H25F3N4O3S |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | N-[4-[(2S)-2-methyl-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | C[C@H]1CN(Cc2cc(F)cc(F)c2F)CCN1C(=O)c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C28H25F3N4O3S/c1-18-16-34(17-21-14-22(29)15-24(30)26(21)31)12-13-35(18)28(36)20-7-9-23(10-8-20)33-39(37,38)25-6-2-4-19-5-3-11-32-27(19)25/h2-11,14-15,18,33H,12-13,16-17H2,1H3/t18-/m0/s1 |
| InChIKey | SEUTZLQLVWZWQQ-SFHVURJKSA-N |
| XLogP | 4.80 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|