C47H49F2NO10 — CID 57410590
ethyl 4,4-difluoro-2-nitro-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate (PubChem CID 57410590) has the molecular formula C47H49F2NO10 and a molecular weight of 825.90 g/mol. Its IUPAC name is ethyl 4,4-difluoro-2-nitro-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate.
| Compound Name | ethyl 4,4-difluoro-2-nitro-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 57410590 |
| Molecular Formula | C47H49F2NO10 |
| Molecular Weight | 825.90 g/mol |
| Exact Mass | 825.33 |
| IUPAC Name | ethyl 4,4-difluoro-2-nitro-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
| SMILES | CCOC(=O)C(CC(F)(F)[C@]1(OCc2ccccc2)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C47H49F2NO10/c1-2-55-45(51)40(50(52)53)28-46(48,49)47(59-33-39-26-16-7-17-27-39)44(58-32-38-24-14-6-15-25-38)43(57-31-37-22-12-5-13-23-37)42(56-30-36-20-10-4-11-21-36)41(60-47)34-54-29-35-18-8-3-9-19-35/h3-27,40-44H,2,28-34H2,1H3/t40?,41-,42+,43+,44-,47-/m1/s1 |
| InChIKey | ZBWHEWIVUXRAOQ-UPLCWWNKSA-N |
| XLogP | 8.51 |
| TPSA | 124.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.90 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|