C35H30N2O2S — CID 57410596
1-benzothiophen-2-yl-[(3S,5S,8S)-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaen-23-yl]methanone (PubChem CID 57410596) has the molecular formula C35H30N2O2S and a molecular weight of 542.70 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[(3S,5S,8S)-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaen-23-yl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[(3S,5S,8S)-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaen-23-yl]methanone |
|---|---|
| PubChem CID | 57410596 |
| Molecular Formula | C35H30N2O2S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1-benzothiophen-2-yl-[(3S,5S,8S)-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaen-23-yl]methanone |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)c1c(c3ccccc3c3nc4ccc(C(=O)c5cc6ccccc6s5)cc4nc13)OC2(C)C |
| InChI | InChI=1S/C35H30N2O2S/c1-19-12-14-25-24(16-19)30-32-31(22-9-5-6-10-23(22)34(30)39-35(25,2)3)36-26-15-13-21(17-27(26)37-32)33(38)29-18-20-8-4-7-11-28(20)40-29/h4-11,13,15,17-19,24-25H,12,14,16H2,1-3H3/t19-,24-,25-/m0/s1 |
| InChIKey | NQTOLKPRLLCSNL-LQGLAIQGSA-N |
| XLogP | 9.07 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|