C29H33NO6 — CID 57410987
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1H-indole-7-carboxylate (PubChem CID 57410987) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1H-indole-7-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 57410987 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1H-indole-7-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1cccc2cc[nH]c12)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C29H33NO6/c1-14-12-28-15(2)10-20-21(27(20,3)4)19(24(28)33)11-17(13-31)23(32)29(28,35)25(14)36-26(34)18-7-5-6-16-8-9-30-22(16)18/h5-9,11-12,15,19-21,23,25,30-32,35H,10,13H2,1-4H3/t15-,19+,20-,21+,23-,25+,28+,29+/m1/s1 |
| InChIKey | JSRNSYJSWVRROG-DJANREAJSA-N |
| XLogP | 3.16 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|