C32H31FN2O4 — CID 57411037
5-[6-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid (PubChem CID 57411037) has the molecular formula C32H31FN2O4 and a molecular weight of 526.61 g/mol. Its IUPAC name is 5-[6-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411037 |
| Molecular Formula | C32H31FN2O4 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 5-[6-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
| SMILES | CC1(C)CC(NC(=O)c2ccc3nc(-c4ccc(F)cc4)c(CCCCC(=O)O)cc3c2)c2ccccc2O1 |
| InChI | InChI=1S/C32H31FN2O4/c1-32(2)19-27(25-8-4-5-9-28(25)39-32)35-31(38)22-13-16-26-23(18-22)17-21(7-3-6-10-29(36)37)30(34-26)20-11-14-24(33)15-12-20/h4-5,8-9,11-18,27H,3,6-7,10,19H2,1-2H3,(H,35,38)(H,36,37) |
| InChIKey | HOONEYVJPDGKTB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|