C31H26N2O2 — CID 57411085
[5-methyl-5-(2-methylprop-1-enyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),8,10,12,14,16(21),17,19-nonaen-18-yl]-phenylmethanone (PubChem CID 57411085) has the molecular formula C31H26N2O2 and a molecular weight of 458.56 g/mol. Its IUPAC name is [5-methyl-5-(2-methylprop-1-enyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),8,10,12,14,16(21),17,19-nonaen-18-yl]-phenylmethanone.
| Compound Name | [5-methyl-5-(2-methylprop-1-enyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),8,10,12,14,16(21),17,19-nonaen-18-yl]-phenylmethanone |
|---|---|
| PubChem CID | 57411085 |
| Molecular Formula | C31H26N2O2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | [5-methyl-5-(2-methylprop-1-enyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),8,10,12,14,16(21),17,19-nonaen-18-yl]-phenylmethanone |
| SMILES | CC(C)=CC1(C)CCc2c(c3ccccc3c3nc4cc(C(=O)c5ccccc5)ccc4nc23)O1 |
| InChI | InChI=1S/C31H26N2O2/c1-19(2)18-31(3)16-15-24-28-27(22-11-7-8-12-23(22)30(24)35-31)33-26-17-21(13-14-25(26)32-28)29(34)20-9-5-4-6-10-20/h4-14,17-18H,15-16H2,1-3H3 |
| InChIKey | QLPHXIBPQGKDDQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|