C26H36O6 — CID 57411104
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] cyclopentanecarboxylate (PubChem CID 57411104) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] cyclopentanecarboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 57411104 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] cyclopentanecarboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)C1CCCC1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C26H36O6/c1-13-11-25-14(2)9-18-19(24(18,3)4)17(21(25)29)10-16(12-27)20(28)26(25,31)22(13)32-23(30)15-7-5-6-8-15/h10-11,14-15,17-20,22,27-28,31H,5-9,12H2,1-4H3/t14-,17+,18-,19+,20-,22+,25+,26+/m1/s1 |
| InChIKey | CGSNVTSPWJMPHZ-XPRIRYNCSA-N |
| XLogP | 2.56 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|