About octyl thiophene-2-carboxylate
octyl thiophene-2-carboxylate (PubChem CID 574116) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is octyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | octyl thiophene-2-carboxylate |
| PubChem CID | 574116 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | octyl thiophene-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C13H20O2S/c1-2-3-4-5-6-7-10-15-13(14)12-9-8-11-16-12/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | XFZZQJMBWJMTED-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl thiophene-2-carboxylate?
The IUPAC name of octyl thiophene-2-carboxylate (CID 574116) is octyl thiophene-2-carboxylate.
What is the SMILES notation for octyl thiophene-2-carboxylate?
The canonical SMILES for octyl thiophene-2-carboxylate is CCCCCCCCOC(=O)c1cccs1.
What is the InChIKey of octyl thiophene-2-carboxylate?
The InChIKey is XFZZQJMBWJMTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-2-3-4-5-6-7-10-15-13(14)12-9-8-11-16-12/h8-9,11H,2-7,10H2,1H3.
What are the key properties of octyl thiophene-2-carboxylate?
octyl thiophene-2-carboxylate has a molecular weight of 240.37 g/mol, XLogP of 4.27, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl thiophene-2-carboxylate is sourced from PubChem (CID 574116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).