C33H40N2O6 — CID 57411684
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-benzyl-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 57411684) has the molecular formula C33H40N2O6 and a molecular weight of 560.69 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-benzyl-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-benzyl-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 57411684 |
| Molecular Formula | C33H40N2O6 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-benzyl-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1c(C)nn(Cc2ccccc2)c1C)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C33H40N2O6/c1-17-14-32-18(2)12-24-26(31(24,5)6)23(28(32)38)13-22(16-36)27(37)33(32,40)29(17)41-30(39)25-19(3)34-35(20(25)4)15-21-10-8-7-9-11-21/h7-11,13-14,18,23-24,26-27,29,36-37,40H,12,15-16H2,1-6H3/t18-,23+,24-,26+,27-,29+,32+,33+/m1/s1 |
| InChIKey | CDRFGYYDYNFVDA-VZBHXHBESA-N |
| XLogP | 3.54 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|