C24H30N2O7 — CID 57411807
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 4-methyl-1,2,5-oxadiazole-3-carboxylate (PubChem CID 57411807) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 4-methyl-1,2,5-oxadiazole-3-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 4-methyl-1,2,5-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 57411807 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 4-methyl-1,2,5-oxadiazole-3-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1nonc1C)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C24H30N2O7/c1-10-8-23-11(2)6-15-16(22(15,4)5)14(19(23)29)7-13(9-27)18(28)24(23,31)20(10)32-21(30)17-12(3)25-33-26-17/h7-8,11,14-16,18,20,27-28,31H,6,9H2,1-5H3/t11-,14+,15-,16+,18-,20+,23+,24+/m1/s1 |
| InChIKey | JTIMBFBIIGEMIO-SCBISHFJSA-N |
| XLogP | 1.37 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|