C30H42O6 — CID 57411810
[(1S,4S,5S,6R,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2,6,6-trimethylcyclohexene-1-carboxylate (PubChem CID 57411810) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(1S,4S,5S,6R,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2,6,6-trimethylcyclohexene-1-carboxylate.
| Compound Name | [(1S,4S,5S,6R,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2,6,6-trimethylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 57411810 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(1S,4S,5S,6R,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2,6,6-trimethylcyclohexene-1-carboxylate |
| SMILES | CC1=C[C@]23C(=O)C(C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)C1=C(C)CCCC1(C)C)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H42O6/c1-15-9-8-10-27(4,5)21(15)26(34)36-25-16(2)13-29-17(3)11-20-22(28(20,6)7)19(24(29)33)12-18(14-31)23(32)30(25,29)35/h12-13,17,19-20,22-23,25,31-32,35H,8-11,14H2,1-7H3/t17-,19?,20-,22+,23-,25+,29+,30+/m1/s1 |
| InChIKey | NRCZJZGHJMTXMO-ZEOIXLTDSA-N |
| XLogP | 3.89 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|