3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid

C16H14N2O2 — CID 57411982

IUPAC3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid
SMILESO=C(O)CCc1cccc(-c2cnc3[nH]ccc3c2)c1
InChIInChI=1S/C16H14N2O2/c19-15(20)5-4-11-2-1-3-12(8-11)14-9-13-6-7-17-16(13)18-10-14/h1-3,6-10H,4-5H2,(H,17,18)(H,19,20)
InChIKeyHMZZTTNTVUPEKW-UHFFFAOYSA-N
MW266.30 g/mol
LogP3.25
Rot. Bonds4

About 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid

3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid (PubChem CID 57411982) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid.

Molecular Properties

Compound Name3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid
PubChem CID57411982
Molecular FormulaC16H14N2O2
Molecular Weight266.30 g/mol
Exact Mass266.11
IUPAC Name3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid
SMILESO=C(O)CCc1cccc(-c2cnc3[nH]ccc3c2)c1
InChIInChI=1S/C16H14N2O2/c19-15(20)5-4-11-2-1-3-12(8-11)14-9-13-6-7-17-16(13)18-10-14/h1-3,6-10H,4-5H2,(H,17,18)(H,19,20)
InChIKeyHMZZTTNTVUPEKW-UHFFFAOYSA-N
XLogP3.25
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.30
LogP ≤ 53.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid?
The IUPAC name of 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid (CID 57411982) is 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid.
What is the SMILES notation for 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid?
The canonical SMILES for 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid is O=C(O)CCc1cccc(-c2cnc3[nH]ccc3c2)c1.
What is the InChIKey of 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid?
The InChIKey is HMZZTTNTVUPEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c19-15(20)5-4-11-2-1-3-12(8-11)14-9-13-6-7-17-16(13)18-10-14/h1-3,6-10H,4-5H2,(H,17,18)(H,19,20).
What are the key properties of 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid?
3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid has a molecular weight of 266.30 g/mol, XLogP of 3.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanoic acid is sourced from PubChem (CID 57411982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).