C34H44N4 — CID 57412131
2-[2-[(6R,6aS,10aS)-11-[2-(dimethylamino)ethyl]-7,7,9-trimethyl-6,6a,8,10a-tetrahydroisoindolo[2,1-a]indol-6-yl]-1H-indol-3-yl]-N,N-dimethylethanamine (PubChem CID 57412131) has the molecular formula C34H44N4 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2-[2-[(6R,6aS,10aS)-11-[2-(dimethylamino)ethyl]-7,7,9-trimethyl-6,6a,8,10a-tetrahydroisoindolo[2,1-a]indol-6-yl]-1H-indol-3-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[(6R,6aS,10aS)-11-[2-(dimethylamino)ethyl]-7,7,9-trimethyl-6,6a,8,10a-tetrahydroisoindolo[2,1-a]indol-6-yl]-1H-indol-3-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 57412131 |
| Molecular Formula | C34H44N4 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | 2-[2-[(6R,6aS,10aS)-11-[2-(dimethylamino)ethyl]-7,7,9-trimethyl-6,6a,8,10a-tetrahydroisoindolo[2,1-a]indol-6-yl]-1H-indol-3-yl]-N,N-dimethylethanamine |
| SMILES | CC1=C[C@@H]2c3c(CCN(C)C)c4ccccc4n3[C@@H](c3[nH]c4ccccc4c3CCN(C)C)[C@@H]2C(C)(C)C1 |
| InChI | InChI=1S/C34H44N4/c1-22-20-27-30(34(2,3)21-22)33(31-25(16-18-36(4)5)23-12-8-10-14-28(23)35-31)38-29-15-11-9-13-24(29)26(32(27)38)17-19-37(6)7/h8-15,20,27,30,33,35H,16-19,21H2,1-7H3/t27-,30+,33+/m0/s1 |
| InChIKey | KTNDVQALWXIUSO-LTXBTDFWSA-N |
| XLogP | 7.01 |
| TPSA | 27.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|