C22H17NO3S — CID 57412359
(2S,4R)-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaen-11-one (PubChem CID 57412359) has the molecular formula C22H17NO3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2S,4R)-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaen-11-one.
| Compound Name | (2S,4R)-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaen-11-one |
|---|---|
| PubChem CID | 57412359 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (2S,4R)-3-(4-methylphenyl)sulfonyl-3-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaen-11-one |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3c4ccccc4C(=O)c4ccccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C22H17NO3S/c1-14-10-12-15(13-11-14)27(25,26)23-20-16-6-2-4-8-18(16)22(24)19-9-5-3-7-17(19)21(20)23/h2-13,20-21H,1H3/t20-,21+,23? |
| InChIKey | UELIWGAEHNCCIO-TYABSZSSSA-N |
| XLogP | 4.03 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|