C17H20N2O3S — CID 57412508
4-(6-ethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide (PubChem CID 57412508) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-(6-ethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide.
| Compound Name | 4-(6-ethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 57412508 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-(6-ethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide |
| SMILES | CCOc1ccc2c(c1)CCNC2c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-22-14-5-8-16-13(11-14)9-10-19-17(16)12-3-6-15(7-4-12)23(18,20)21/h3-8,11,17,19H,2,9-10H2,1H3,(H2,18,20,21) |
| InChIKey | AUFUQBMVEMXWGR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |