C18H22N2O3S — CID 57412509
4-(6-propoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide (PubChem CID 57412509) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-(6-propoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide.
| Compound Name | 4-(6-propoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 57412509 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-(6-propoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide |
| SMILES | CCCOc1ccc2c(c1)CCNC2c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-2-11-23-15-5-8-17-14(12-15)9-10-20-18(17)13-3-6-16(7-4-13)24(19,21)22/h3-8,12,18,20H,2,9-11H2,1H3,(H2,19,21,22) |
| InChIKey | LCSOKKPGIKPBDO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |