C21H37NOSi — CID 57412515
(3E)-5,5-dimethyl-2-(6-methylhept-6-en-2-yl)-2-trimethylsilyloxyocta-3,7-dienenitrile (PubChem CID 57412515) has the molecular formula C21H37NOSi and a molecular weight of 347.62 g/mol. Its IUPAC name is (3E)-5,5-dimethyl-2-(6-methylhept-6-en-2-yl)-2-trimethylsilyloxyocta-3,7-dienenitrile.
| Compound Name | (3E)-5,5-dimethyl-2-(6-methylhept-6-en-2-yl)-2-trimethylsilyloxyocta-3,7-dienenitrile |
|---|---|
| PubChem CID | 57412515 |
| Molecular Formula | C21H37NOSi |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | (3E)-5,5-dimethyl-2-(6-methylhept-6-en-2-yl)-2-trimethylsilyloxyocta-3,7-dienenitrile |
| SMILES | C=CCC(C)(C)/C=C/C(C#N)(O[Si](C)(C)C)C(C)CCCC(=C)C |
| InChI | InChI=1S/C21H37NOSi/c1-10-14-20(5,6)15-16-21(17-22,23-24(7,8)9)19(4)13-11-12-18(2)3/h10,15-16,19H,1-2,11-14H2,3-9H3/b16-15+ |
| InChIKey | USAYSLKTRSJGNI-FOCLMDBBSA-N |
| XLogP | 6.64 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|