C19H33NOSi — CID 57412516
(2E,6E)-4,4,7,11-tetramethyl-1-trimethylsilyloxycycloundeca-2,6-diene-1-carbonitrile (PubChem CID 57412516) has the molecular formula C19H33NOSi and a molecular weight of 319.57 g/mol. Its IUPAC name is (2E,6E)-4,4,7,11-tetramethyl-1-trimethylsilyloxycycloundeca-2,6-diene-1-carbonitrile.
| Compound Name | (2E,6E)-4,4,7,11-tetramethyl-1-trimethylsilyloxycycloundeca-2,6-diene-1-carbonitrile |
|---|---|
| PubChem CID | 57412516 |
| Molecular Formula | C19H33NOSi |
| Molecular Weight | 319.57 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2E,6E)-4,4,7,11-tetramethyl-1-trimethylsilyloxycycloundeca-2,6-diene-1-carbonitrile |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(C#N)(O[Si](C)(C)C)C(C)CCC1 |
| InChI | InChI=1S/C19H33NOSi/c1-16-9-8-10-17(2)19(15-20,21-22(5,6)7)14-13-18(3,4)12-11-16/h11,13-14,17H,8-10,12H2,1-7H3/b14-13+,16-11+ |
| InChIKey | HCHDYBVACYBOKQ-JXZFAPNESA-N |
| XLogP | 5.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|