C28H35ClN2 — CID 57412849
(1R,9R,10R)-N-[(4-chlorophenyl)methyl]-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 57412849) has the molecular formula C28H35ClN2 and a molecular weight of 435.06 g/mol. Its IUPAC name is (1R,9R,10R)-N-[(4-chlorophenyl)methyl]-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-N-[(4-chlorophenyl)methyl]-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 57412849 |
| Molecular Formula | C28H35ClN2 |
| Molecular Weight | 435.06 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (1R,9R,10R)-N-[(4-chlorophenyl)methyl]-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | Clc1ccc(CNc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@@H](C3)N(CC2CCC2)CC4)cc1 |
| InChI | InChI=1S/C28H35ClN2/c29-23-10-7-20(8-11-23)18-30-24-12-9-22-16-27-25-6-1-2-13-28(25,26(22)17-24)14-15-31(27)19-21-4-3-5-21/h7-12,17,21,25,27,30H,1-6,13-16,18-19H2/t25-,27+,28+/m0/s1 |
| InChIKey | BBYKCBUNRNWVLP-KJYTXNCISA-N |
| XLogP | 6.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.06 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |