C30H40N2O — CID 57413039
(1R,9R,10R)-17-(cyclobutylmethyl)-N-[(2-methoxyphenyl)methyl]-N-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 57413039) has the molecular formula C30H40N2O and a molecular weight of 444.66 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(2-methoxyphenyl)methyl]-N-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(2-methoxyphenyl)methyl]-N-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 57413039 |
| Molecular Formula | C30H40N2O |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(2-methoxyphenyl)methyl]-N-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | COc1ccccc1CN(C)c1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C30H40N2O/c1-31(21-24-10-3-4-12-29(24)33-2)25-14-13-23-18-28-26-11-5-6-15-30(26,27(23)19-25)16-17-32(28)20-22-8-7-9-22/h3-4,10,12-14,19,22,26,28H,5-9,11,15-18,20-21H2,1-2H3/t26-,28+,30+/m0/s1 |
| InChIKey | LZDWRTMQEQSFMP-CVXIRMMQSA-N |
| XLogP | 6.19 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |