C31H56O3Si2 — CID 57413147
(3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-cyclohepta[e]inden-8-one (PubChem CID 57413147) has the molecular formula C31H56O3Si2 and a molecular weight of 532.96 g/mol. Its IUPAC name is (3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-cyclohepta[e]inden-8-one.
| Compound Name | (3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-cyclohepta[e]inden-8-one |
|---|---|
| PubChem CID | 57413147 |
| Molecular Formula | C31H56O3Si2 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-cyclohepta[e]inden-8-one |
| SMILES | CC(C)C1=C2C3=CCC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@@]2(C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H56O3Si2/c1-21(2)23-20-26(34-36(13,14)29(6,7)8)31(10)18-17-30(9)24(27(23)31)16-15-22(32)19-25(30)33-35(11,12)28(3,4)5/h16,21,25-26H,15,17-20H2,1-14H3/t25-,26+,30+,31-/m0/s1 |
| InChIKey | KCCWGAHOOJFFOP-ZBKRMGPDSA-N |
| XLogP | 9.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|