C32H55F3O5SSi2 — CID 57413148
[(3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate (PubChem CID 57413148) has the molecular formula C32H55F3O5SSi2 and a molecular weight of 665.02 g/mol. Its IUPAC name is [(3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57413148 |
| Molecular Formula | C32H55F3O5SSi2 |
| Molecular Weight | 665.02 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | [(3R,3aR,5aR,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate |
| SMILES | CC(C)C1=C2C3=CC=C(OS(=O)(=O)C(F)(F)F)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@@]2(C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H55F3O5SSi2/c1-21(2)23-20-26(40-43(13,14)29(6,7)8)31(10)18-17-30(9)24(27(23)31)16-15-22(38-41(36,37)32(33,34)35)19-25(30)39-42(11,12)28(3,4)5/h15-16,21,25-26H,17-20H2,1-14H3/t25-,26+,30+,31-/m0/s1 |
| InChIKey | GSAGQKJNXYYEAD-ZBKRMGPDSA-N |
| XLogP | 10.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.02 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|