C17H33NO7Si — CID 57413255
methyl (3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-6-(2-trimethylsilylethoxymethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 57413255) has the molecular formula C17H33NO7Si and a molecular weight of 391.54 g/mol. Its IUPAC name is methyl (3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-6-(2-trimethylsilylethoxymethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | methyl (3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-6-(2-trimethylsilylethoxymethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 57413255 |
| Molecular Formula | C17H33NO7Si |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | methyl (3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-6-(2-trimethylsilylethoxymethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | COC(=O)N1C[C@H]2OC(C)(C)O[C@H]2[C@H](O)[C@H]1COCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H33NO7Si/c1-17(2)24-13-9-18(16(20)21-3)12(14(19)15(13)25-17)10-23-11-22-7-8-26(4,5)6/h12-15,19H,7-11H2,1-6H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | BNTVEVHQWATAOW-KBUPBQIOSA-N |
| XLogP | 1.65 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|