C28H33ClFNO4 — CID 57413376
3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid;hydrochloride (PubChem CID 57413376) has the molecular formula C28H33ClFNO4 and a molecular weight of 502.03 g/mol. Its IUPAC name is 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid;hydrochloride.
| Compound Name | 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 57413376 |
| Molecular Formula | C28H33ClFNO4 |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid;hydrochloride |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(CNc3ccc(CCC(=O)O)c(F)c3)c2)c(C)c1.Cl |
| InChI | InChI=1S/C28H32FNO4.ClH/c1-4-33-12-13-34-25-14-19(2)28(20(3)15-25)23-7-5-6-21(16-23)18-30-24-10-8-22(26(29)17-24)9-11-27(31)32;/h5-8,10,14-17,30H,4,9,11-13,18H2,1-3H3,(H,31,32);1H |
| InChIKey | VIGZKOVIECVYOJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|