C29H49NO3Si — CID 57413410
tert-butyl (2S,5R)-2-[(2S)-2-phenylmethoxyheptyl]-5-[(E)-3-trimethylsilylprop-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 57413410) has the molecular formula C29H49NO3Si and a molecular weight of 487.80 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-[(2S)-2-phenylmethoxyheptyl]-5-[(E)-3-trimethylsilylprop-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2-[(2S)-2-phenylmethoxyheptyl]-5-[(E)-3-trimethylsilylprop-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57413410 |
| Molecular Formula | C29H49NO3Si |
| Molecular Weight | 487.80 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | tert-butyl (2S,5R)-2-[(2S)-2-phenylmethoxyheptyl]-5-[(E)-3-trimethylsilylprop-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCC[C@@H](C[C@@H]1CC[C@H](C/C=C/[Si](C)(C)C)N1C(=O)OC(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C29H49NO3Si/c1-8-9-11-18-27(32-23-24-15-12-10-13-16-24)22-26-20-19-25(17-14-21-34(5,6)7)30(26)28(31)33-29(2,3)4/h10,12-16,21,25-27H,8-9,11,17-20,22-23H2,1-7H3/b21-14+/t25-,26-,27-/m0/s1 |
| InChIKey | VYZNOGNCYJWXES-FHFCLKOZSA-N |
| XLogP | 8.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.80 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|