C37H38N2Na2O10S3+2 — CID 57413636
disodium;2-[bis[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid (PubChem CID 57413636) has the molecular formula C37H38N2Na2O10S3+2 and a molecular weight of 812.90 g/mol. Its IUPAC name is disodium;2-[bis[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid.
| Compound Name | disodium;2-[bis[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 57413636 |
| Molecular Formula | C37H38N2Na2O10S3+2 |
| Molecular Weight | 812.90 g/mol |
| Exact Mass | 812.15 |
| IUPAC Name | disodium;2-[bis[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1ccc(C(c2ccc(N(CC)Cc3cccc(S(=O)(=O)O)c3)cc2)c2ccc(O)cc2S(=O)(=O)O)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C37H38N2O10S3.2Na/c1-3-38(24-26-7-5-9-33(21-26)50(41,42)43)30-15-11-28(12-16-30)37(35-20-19-32(40)23-36(35)52(47,48)49)29-13-17-31(18-14-29)39(4-2)25-27-8-6-10-34(22-27)51(44,45)46;;/h5-23,37,40H,3-4,24-25H2,1-2H3,(H,41,42,43)(H,44,45,46)(H,47,48,49);;/q;2*+1 |
| InChIKey | BRVXGZISMNESGE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.90 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|