C21H22F3NO7 — CID 57413865
N-methyl-3-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide (PubChem CID 57413865) has the molecular formula C21H22F3NO7 and a molecular weight of 457.40 g/mol. Its IUPAC name is N-methyl-3-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide.
| Compound Name | N-methyl-3-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 57413865 |
| Molecular Formula | C21H22F3NO7 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-methyl-3-[3-(trifluoromethyl)-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H22F3NO7/c1-25-19(30)12-4-2-3-10(7-12)11-5-6-14(13(8-11)21(22,23)24)31-20-18(29)17(28)16(27)15(9-26)32-20/h2-8,15-18,20,26-29H,9H2,1H3,(H,25,30)/t15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | KZDHHZMMBYAYEG-JGLNRKDHSA-N |
| XLogP | 0.91 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |