C25H29NO3S — CID 57413895
(4R,9'aS)-1'-(4-methylphenyl)sulfonylspiro[1,3-dihydroisochromene-4,2'-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]pyrrole] (PubChem CID 57413895) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is (4R,9'aS)-1'-(4-methylphenyl)sulfonylspiro[1,3-dihydroisochromene-4,2'-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]pyrrole].
| Compound Name | (4R,9'aS)-1'-(4-methylphenyl)sulfonylspiro[1,3-dihydroisochromene-4,2'-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]pyrrole] |
|---|---|
| PubChem CID | 57413895 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (4R,9'aS)-1'-(4-methylphenyl)sulfonylspiro[1,3-dihydroisochromene-4,2'-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]pyrrole] |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3CCCCCCC3=C[C@@]23COCc2ccccc23)cc1 |
| InChI | InChI=1S/C25H29NO3S/c1-19-12-14-22(15-13-19)30(27,28)26-24-11-5-3-2-4-8-20(24)16-25(26)18-29-17-21-9-6-7-10-23(21)25/h6-7,9-10,12-16,24H,2-5,8,11,17-18H2,1H3/t24-,25-/m0/s1 |
| InChIKey | WFOLALPYYCIILP-DQEYMECFSA-N |
| XLogP | 5.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|