C24H30N2O7 — CID 57414004
(4-methylpiperazin-1-yl)-[3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone (PubChem CID 57414004) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone |
|---|---|
| PubChem CID | 57414004 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-c3ccc(O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)cc3)c2)CC1 |
| InChI | InChI=1S/C24H30N2O7/c1-25-9-11-26(12-10-25)23(31)17-4-2-3-16(13-17)15-5-7-18(8-6-15)32-24-22(30)21(29)20(28)19(14-27)33-24/h2-8,13,19-22,24,27-30H,9-12,14H2,1H3/t19-,20-,21+,22+,24+/m1/s1 |
| InChIKey | XLNSFYPMFKMJFG-NTYLBUJVSA-N |
| XLogP | -0.08 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |