C22H25N2NaO2S — CID 57414178
sodium 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-ide (PubChem CID 57414178) has the molecular formula C22H25N2NaO2S and a molecular weight of 404.51 g/mol. Its IUPAC name is sodium 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-ide.
| Compound Name | sodium 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-ide |
|---|---|
| PubChem CID | 57414178 |
| Molecular Formula | C22H25N2NaO2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | sodium 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-ide |
| SMILES | CN1CCC[C@@H]1Cc1c[n-]c2ccc(CCS(=O)(=O)c3ccccc3)cc12.[Na+] |
| InChI | InChI=1S/C22H25N2O2S.Na/c1-24-12-5-6-19(24)15-18-16-23-22-10-9-17(14-21(18)22)11-13-27(25,26)20-7-3-2-4-8-20;/h2-4,7-10,14,16,19H,5-6,11-13,15H2,1H3;/q-1;+1/t19-;/m1./s1 |
| InChIKey | LSFHLRVRXJMEBW-FSRHSHDFSA-N |
| XLogP | 0.45 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |