About [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol
[5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol (PubChem CID 57414298) has the molecular formula C20H19NO
and a molecular weight of 289.38 g/mol. Its IUPAC name is [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol |
| PubChem CID | 57414298 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol |
| SMILES | OCc1ccc(C(/C=C/c2ccccc2)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C20H19NO/c22-15-18-12-14-20(21-18)19(17-9-5-2-6-10-17)13-11-16-7-3-1-4-8-16/h1-14,19,21-22H,15H2/b13-11+ |
| InChIKey | PESSGCWOQIUPMJ-ACCUITESSA-N |
| XLogP | 4.35 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol?
The IUPAC name of [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol (CID 57414298) is [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol.
What is the SMILES notation for [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol?
The canonical SMILES for [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol is OCc1ccc(C(/C=C/c2ccccc2)c2ccccc2)[nH]1.
What is the InChIKey of [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol?
The InChIKey is PESSGCWOQIUPMJ-ACCUITESSA-N. The full InChI is InChI=1S/C20H19NO/c22-15-18-12-14-20(21-18)19(17-9-5-2-6-10-17)13-11-16-7-3-1-4-8-16/h1-14,19,21-22H,15H2/b13-11+.
What are the key properties of [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol?
[5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol has a molecular weight of 289.38 g/mol, XLogP of 4.35, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(E)-1,3-diphenylprop-2-enyl]-1H-pyrrol-2-yl]methanol is sourced from PubChem (CID 57414298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).