C36H71N7O4 — CID 57414406
(Z)-N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[4-aminobutanoyl-(2-amino-2-oxoethyl)amino]hexan-2-yl]amino]-1-oxohexan-2-yl]octadec-9-enamide (PubChem CID 57414406) has the molecular formula C36H71N7O4 and a molecular weight of 666.01 g/mol. Its IUPAC name is (Z)-N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[4-aminobutanoyl-(2-amino-2-oxoethyl)amino]hexan-2-yl]amino]-1-oxohexan-2-yl]octadec-9-enamide.
| Compound Name | (Z)-N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[4-aminobutanoyl-(2-amino-2-oxoethyl)amino]hexan-2-yl]amino]-1-oxohexan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 57414406 |
| Molecular Formula | C36H71N7O4 |
| Molecular Weight | 666.01 g/mol |
| Exact Mass | 665.56 |
| IUPAC Name | (Z)-N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[4-aminobutanoyl-(2-amino-2-oxoethyl)amino]hexan-2-yl]amino]-1-oxohexan-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)CN(CC(N)=O)C(=O)CCCN |
| InChI | InChI=1S/C36H71N7O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-24-34(45)42-32(23-18-20-27-38)36(47)41-31(22-17-19-26-37)29-43(30-33(40)44)35(46)25-21-28-39/h9-10,31-32H,2-8,11-30,37-39H2,1H3,(H2,40,44)(H,41,47)(H,42,45)/b10-9-/t31-,32-/m0/s1 |
| InChIKey | BPQALKPIEQLKJE-YWUGPAMUSA-N |
| XLogP | 4.30 |
| TPSA | 199.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|