C17H21NO4 — CID 57414414
benzyl (3R,3aS,6S,7aR)-3,6-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate (PubChem CID 57414414) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is benzyl (3R,3aS,6S,7aR)-3,6-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate.
| Compound Name | benzyl (3R,3aS,6S,7aR)-3,6-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 57414414 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | benzyl (3R,3aS,6S,7aR)-3,6-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate |
| SMILES | C[C@H]1C[C@H]2OC(=O)[C@H](C)[C@@H]2N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H21NO4/c1-11-8-14-15(12(2)16(19)22-14)18(9-11)17(20)21-10-13-6-4-3-5-7-13/h3-7,11-12,14-15H,8-10H2,1-2H3/t11-,12+,14+,15-/m0/s1 |
| InChIKey | XWWVKTGOLHDNCM-MXYBEHONSA-N |
| XLogP | 2.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |